About [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene
[acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene (PubChem CID 159602441) has the molecular formula C20H28I2O4
and a molecular weight of 586.25 g/mol. Its IUPAC name is [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene.
Molecular Properties
| Compound Name | [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene |
| PubChem CID | 159602441 |
| Molecular Formula | C20H28I2O4 |
| Molecular Weight | 586.25 g/mol |
| Exact Mass | 586.01 |
| IUPAC Name | [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene |
| SMILES | CC.CC.CC(=O)OI(OC(C)=O)c1ccccc1.Ic1ccccc1 |
| InChI | InChI=1S/C10H11IO4.C6H5I.2C2H6/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10;7-6-4-2-1-3-5-6;2*1-2/h3-7H,1-2H3;1-5H;2*1-2H3 |
| InChIKey | MLQQQYXAYFYQNH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.25 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene?
The IUPAC name of [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene (CID 159602441) is [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene.
What is the SMILES notation for [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene?
The canonical SMILES for [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene is CC.CC.CC(=O)OI(OC(C)=O)c1ccccc1.Ic1ccccc1.
What is the InChIKey of [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene?
The InChIKey is MLQQQYXAYFYQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO4.C6H5I.2C2H6/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10;7-6-4-2-1-3-5-6;2*1-2/h3-7H,1-2H3;1-5H;2*1-2H3.
What are the key properties of [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene?
[acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene has a molecular weight of 586.25 g/mol, XLogP of 6.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy(phenyl)-λ3-iodanyl] acetate;ethane;iodobenzene is sourced from PubChem (CID 159602441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).