About [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide
[acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide (PubChem CID 100924232) has the molecular formula C8H8IN3O2
and a molecular weight of 305.08 g/mol. Its IUPAC name is [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide.
Molecular Properties
| Compound Name | [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide |
| PubChem CID | 100924232 |
| Molecular Formula | C8H8IN3O2 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide |
| SMILES | CC(=O)OI(#[N+]N=[N-])c1ccccc1 |
| InChI | InChI=1S/C8H8IN3O2/c1-7(13)14-9(11-12-10)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | ZCSOREBBSWIHHG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide?
The IUPAC name of [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide (CID 100924232) is [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide.
What is the SMILES notation for [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide?
The canonical SMILES for [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide is CC(=O)OI(#[N+]N=[N-])c1ccccc1.
What is the InChIKey of [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide?
The InChIKey is ZCSOREBBSWIHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8IN3O2/c1-7(13)14-9(11-12-10)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide?
[acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide has a molecular weight of 305.08 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy(phenyl)-λ5-iodanylidyne]azaniumyliminoazanide is sourced from PubChem (CID 100924232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).