C25H24N4O2 — CID 159603490
4-[3-[5-(aminomethyl)-1H-indol-2-yl]-3-oxopropyl]-N-(2-aminophenyl)benzamide (PubChem CID 159603490) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[3-[5-(aminomethyl)-1H-indol-2-yl]-3-oxopropyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[3-[5-(aminomethyl)-1H-indol-2-yl]-3-oxopropyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 159603490 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-[3-[5-(aminomethyl)-1H-indol-2-yl]-3-oxopropyl]-N-(2-aminophenyl)benzamide |
| SMILES | NCc1ccc2[nH]c(C(=O)CCc3ccc(C(=O)Nc4ccccc4N)cc3)cc2c1 |
| InChI | InChI=1S/C25H24N4O2/c26-15-17-7-11-21-19(13-17)14-23(28-21)24(30)12-8-16-5-9-18(10-6-16)25(31)29-22-4-2-1-3-20(22)27/h1-7,9-11,13-14,28H,8,12,15,26-27H2,(H,29,31) |
| InChIKey | MLUBZCGTNOCIMU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|