About (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane
(3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane (PubChem CID 159603739) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane.
Molecular Properties
| Compound Name | (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane |
| PubChem CID | 159603739 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane |
| SMILES | C.CC[C@H](C)[C@H](CC(C)=O)C(=O)CN[C@@H](C)C(=O)CN |
| InChI | InChI=1S/C14H26N2O3.CH4/c1-5-9(2)12(6-10(3)17)14(19)8-16-11(4)13(18)7-15;/h9,11-12,16H,5-8,15H2,1-4H3;1H4/t9-,11-,12-;/m0./s1 |
| InChIKey | MLUUHUZFCNNBAR-LBRAPMIBSA-N |
| XLogP | 1.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane?
The IUPAC name of (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane (CID 159603739) is (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane.
What is the SMILES notation for (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane?
The canonical SMILES for (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane is C.CC[C@H](C)[C@H](CC(C)=O)C(=O)CN[C@@H](C)C(=O)CN.
What is the InChIKey of (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane?
The InChIKey is MLUUHUZFCNNBAR-LBRAPMIBSA-N. The full InChI is InChI=1S/C14H26N2O3.CH4/c1-5-9(2)12(6-10(3)17)14(19)8-16-11(4)13(18)7-15;/h9,11-12,16H,5-8,15H2,1-4H3;1H4/t9-,11-,12-;/m0./s1.
What are the key properties of (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane?
(3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane has a molecular weight of 286.42 g/mol, XLogP of 1.34, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[[(2S)-4-amino-3-oxobutan-2-yl]amino]-3-[(2S)-butan-2-yl]hexane-2,5-dione;methane is sourced from PubChem (CID 159603739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).