C21H28N2O8 — CID 159608158
2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol (PubChem CID 159608158) has the molecular formula C21H28N2O8 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol.
| Compound Name | 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 159608158 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol |
| SMILES | CC(C)(O)COc1ccc([N+](=O)[O-])cc1.CC1(C)CO1.Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C10H13NO4.C7H7NO3.C4H8O/c1-10(2,12)7-15-9-5-3-8(4-6-9)11(13)14;1-5-4-6(8(10)11)2-3-7(5)9;1-4(2)3-5-4/h3-6,12H,7H2,1-2H3;2-4,9H,1H3;3H2,1-2H3 |
| InChIKey | MMILJAYLFROFHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|