About 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol
2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol (PubChem CID 159608158) has the molecular formula C21H28N2O8
and a molecular weight of 436.46 g/mol. Its IUPAC name is 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol.
Molecular Properties
| Compound Name | 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol |
| PubChem CID | 159608158 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol |
| SMILES | CC(C)(O)COc1ccc([N+](=O)[O-])cc1.CC1(C)CO1.Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C10H13NO4.C7H7NO3.C4H8O/c1-10(2,12)7-15-9-5-3-8(4-6-9)11(13)14;1-5-4-6(8(10)11)2-3-7(5)9;1-4(2)3-5-4/h3-6,12H,7H2,1-2H3;2-4,9H,1H3;3H2,1-2H3 |
| InChIKey | MMILJAYLFROFHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol?
The IUPAC name of 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol (CID 159608158) is 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol.
What is the SMILES notation for 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol?
The canonical SMILES for 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol is CC(C)(O)COc1ccc([N+](=O)[O-])cc1.CC1(C)CO1.Cc1cc([N+](=O)[O-])ccc1O.
What is the InChIKey of 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol?
The InChIKey is MMILJAYLFROFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4.C7H7NO3.C4H8O/c1-10(2,12)7-15-9-5-3-8(4-6-9)11(13)14;1-5-4-6(8(10)11)2-3-7(5)9;1-4(2)3-5-4/h3-6,12H,7H2,1-2H3;2-4,9H,1H3;3H2,1-2H3.
What are the key properties of 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol?
2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol has a molecular weight of 436.46 g/mol, XLogP of 4.15, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxirane;2-methyl-4-nitrophenol;2-methyl-1-(4-nitrophenoxy)propan-2-ol is sourced from PubChem (CID 159608158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).