C39H75NO11Si3 — CID 159611667
[2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]-2-[[2-[3,3,5-trimethyl-5-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]acetyl]oxymethyl]butyl] butanoate (PubChem CID 159611667) has the molecular formula C39H75NO11Si3 and a molecular weight of 818.28 g/mol. Its IUPAC name is [2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]-2-[[2-[3,3,5-trimethyl-5-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]acetyl]oxymethyl]butyl] butanoate.
| Compound Name | [2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]-2-[[2-[3,3,5-trimethyl-5-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]acetyl]oxymethyl]butyl] butanoate |
|---|---|
| PubChem CID | 159611667 |
| Molecular Formula | C39H75NO11Si3 |
| Molecular Weight | 818.28 g/mol |
| Exact Mass | 817.46 |
| IUPAC Name | [2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]-2-[[2-[3,3,5-trimethyl-5-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]acetyl]oxymethyl]butyl] butanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCC1(C)CC(CC(=O)OCC(CC)(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)COC(=O)CCC)CC(C)(C)C1 |
| InChI | InChI=1S/C39H75NO11Si3/c1-15-18-33(41)48-29-39(16-2,28-45-19-17-22-54(14,50-52(8,9)10)51-53(11,12)13)30-49-34(42)23-32-24-37(5,6)26-38(7,25-32)27-40-36(44)47-21-20-46-35(43)31(3)4/h32H,3,15-30H2,1-2,4-14H3,(H,40,44) |
| InChIKey | LRXWKNHZCCTRDC-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.28 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|