C34H58N2O8 — CID 90879860
2-[[1,3,3-trimethyl-5-[[3,3,5-trimethyl-5-[(2-propanoyloxyethoxycarbonylamino)methyl]cyclohexyl]methyl]cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 90879860) has the molecular formula C34H58N2O8 and a molecular weight of 622.84 g/mol. Its IUPAC name is 2-[[1,3,3-trimethyl-5-[[3,3,5-trimethyl-5-[(2-propanoyloxyethoxycarbonylamino)methyl]cyclohexyl]methyl]cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[1,3,3-trimethyl-5-[[3,3,5-trimethyl-5-[(2-propanoyloxyethoxycarbonylamino)methyl]cyclohexyl]methyl]cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90879860 |
| Molecular Formula | C34H58N2O8 |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.42 |
| IUPAC Name | 2-[[1,3,3-trimethyl-5-[[3,3,5-trimethyl-5-[(2-propanoyloxyethoxycarbonylamino)methyl]cyclohexyl]methyl]cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCC1(C)CC(CC2CC(C)(C)CC(C)(CNC(=O)OCCOC(=O)CC)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C34H58N2O8/c1-10-27(37)41-11-13-43-29(39)35-22-33(8)18-25(16-31(4,5)20-33)15-26-17-32(6,7)21-34(9,19-26)23-36-30(40)44-14-12-42-28(38)24(2)3/h25-26H,2,10-23H2,1,3-9H3,(H,35,39)(H,36,40) |
| InChIKey | LWQJZCUPNCHXKH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|