C36H59ClN2O2 — CID 159623674
adamantane-1-carbonyl chloride;1-adamantyl-(3,3-dimethylpiperidin-1-yl)methanone;3,3-dimethylpiperidine (PubChem CID 159623674) has the molecular formula C36H59ClN2O2 and a molecular weight of 587.33 g/mol. Its IUPAC name is adamantane-1-carbonyl chloride;1-adamantyl-(3,3-dimethylpiperidin-1-yl)methanone;3,3-dimethylpiperidine.
| Compound Name | adamantane-1-carbonyl chloride;1-adamantyl-(3,3-dimethylpiperidin-1-yl)methanone;3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 159623674 |
| Molecular Formula | C36H59ClN2O2 |
| Molecular Weight | 587.33 g/mol |
| Exact Mass | 586.43 |
| IUPAC Name | adamantane-1-carbonyl chloride;1-adamantyl-(3,3-dimethylpiperidin-1-yl)methanone;3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCN(C(=O)C23CC4CC(CC(C4)C2)C3)C1.CC1(C)CCCNC1.O=C(Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO.C11H15ClO.C7H15N/c1-17(2)4-3-5-19(12-17)16(20)18-9-13-6-14(10-18)8-15(7-13)11-18;12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;1-7(2)4-3-5-8-6-7/h13-15H,3-12H2,1-2H3;7-9H,1-6H2;8H,3-6H2,1-2H3 |
| InChIKey | MOFGWVOAYYIOIW-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.33 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|