C23H29FN2O2 — CID 159631120
(3S)-3-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]-1-(6-methoxy-3-pyridinyl)pentan-1-one (PubChem CID 159631120) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (3S)-3-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]-1-(6-methoxy-3-pyridinyl)pentan-1-one.
| Compound Name | (3S)-3-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]-1-(6-methoxy-3-pyridinyl)pentan-1-one |
|---|---|
| PubChem CID | 159631120 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3S)-3-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]-1-(6-methoxy-3-pyridinyl)pentan-1-one |
| SMILES | CC[C@@H](CC(=O)c1ccc(OC)nc1)C1CCC(c2ccnc(F)c2C)CC1 |
| InChI | InChI=1S/C23H29FN2O2/c1-4-16(13-21(27)19-9-10-22(28-3)26-14-19)17-5-7-18(8-6-17)20-11-12-25-23(24)15(20)2/h9-12,14,16-18H,4-8,13H2,1-3H3/t16-,17?,18?/m0/s1 |
| InChIKey | LBYJNSAJAIKVIE-AOCRQIFASA-N |
| XLogP | 5.51 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|