C26H26FN3O2 — CID 161008356
3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-4-isocyano-1-(6-methoxy-3-pyridinyl)butan-1-one (PubChem CID 161008356) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-4-isocyano-1-(6-methoxy-3-pyridinyl)butan-1-one.
| Compound Name | 3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-4-isocyano-1-(6-methoxy-3-pyridinyl)butan-1-one |
|---|---|
| PubChem CID | 161008356 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-4-isocyano-1-(6-methoxy-3-pyridinyl)butan-1-one |
| SMILES | [C-]#[N+]CC(CC(=O)c1ccc(OC)nc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C26H26FN3O2/c1-28-15-20(13-25(31)19-7-10-26(32-2)30-16-19)17-3-5-18(6-4-17)22-11-12-29-24-9-8-21(27)14-23(22)24/h7-12,14,16-18,20H,3-6,13,15H2,2H3 |
| InChIKey | TWUMSQWFFXEUPU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 56.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|