C19H28FNO3 — CID 142752041
ethyl 3-ethoxy-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanoate (PubChem CID 142752041) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is ethyl 3-ethoxy-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanoate.
| Compound Name | ethyl 3-ethoxy-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 142752041 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | ethyl 3-ethoxy-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanoate |
| SMILES | CCOCC(C(=O)OCC)C1CCC(c2ccnc(F)c2C)CC1 |
| InChI | InChI=1S/C19H28FNO3/c1-4-23-12-17(19(22)24-5-2)15-8-6-14(7-9-15)16-10-11-21-18(20)13(16)3/h10-11,14-15,17H,4-9,12H2,1-3H3 |
| InChIKey | SPPYXMVWQVCVMI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|