C25H26F7N3O3 — CID 159633063
1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one (PubChem CID 159633063) has the molecular formula C25H26F7N3O3 and a molecular weight of 549.49 g/mol. Its IUPAC name is 1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one.
| Compound Name | 1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 159633063 |
| Molecular Formula | C25H26F7N3O3 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one |
| SMILES | Cc1cc(OCc2c(F)cncc2F)c2nc(C)c(C(=O)CC(CCC(F)(F)C(F)(F)F)C(C)(C)O)n2c1 |
| InChI | InChI=1S/C25H26F7N3O3/c1-13-7-20(38-12-16-17(26)9-33-10-18(16)27)22-34-14(2)21(35(22)11-13)19(36)8-15(23(3,4)37)5-6-24(28,29)25(30,31)32/h7,9-11,15,37H,5-6,8,12H2,1-4H3 |
| InChIKey | MPJLQCMPJCRSKR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|