C26H26F8N2O3 — CID 160956973
1-[2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one (PubChem CID 160956973) has the molecular formula C26H26F8N2O3 and a molecular weight of 566.49 g/mol. Its IUPAC name is 1-[2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one.
| Compound Name | 1-[2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 160956973 |
| Molecular Formula | C26H26F8N2O3 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 1-[2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6,6,7,7,7-pentafluoro-3-(2-hydroxypropan-2-yl)heptan-1-one |
| SMILES | Cc1cc(OCc2c(F)ccc(F)c2F)c2nc(C)c(C(=O)CC(CCC(F)(F)C(F)(F)F)C(C)(C)O)n2c1 |
| InChI | InChI=1S/C26H26F8N2O3/c1-13-9-20(39-12-16-17(27)5-6-18(28)21(16)29)23-35-14(2)22(36(23)11-13)19(37)10-15(24(3,4)38)7-8-25(30,31)26(32,33)34/h5-6,9,11,15,38H,7-8,10,12H2,1-4H3 |
| InChIKey | SWMZPPGYSNRXAZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|