C25H28F5N3O3 — CID 159475900
1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7,7-trifluoro-3-(2-hydroxypropan-2-yl)heptan-1-one (PubChem CID 159475900) has the molecular formula C25H28F5N3O3 and a molecular weight of 513.51 g/mol. Its IUPAC name is 1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7,7-trifluoro-3-(2-hydroxypropan-2-yl)heptan-1-one.
| Compound Name | 1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7,7-trifluoro-3-(2-hydroxypropan-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 159475900 |
| Molecular Formula | C25H28F5N3O3 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 1-[8-[(3,5-difluoro-4-pyridinyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7,7-trifluoro-3-(2-hydroxypropan-2-yl)heptan-1-one |
| SMILES | Cc1cc(OCc2c(F)cncc2F)c2nc(C)c(C(=O)CC(CCCC(F)(F)F)C(C)(C)O)n2c1 |
| InChI | InChI=1S/C25H28F5N3O3/c1-14-8-21(36-13-17-18(26)10-31-11-19(17)27)23-32-15(2)22(33(23)12-14)20(34)9-16(24(3,4)35)6-5-7-25(28,29)30/h8,10-12,16,35H,5-7,9,13H2,1-4H3 |
| InChIKey | LWJLEZPOOCZGLU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |