C21H21F3N4O3 — CID 118385328
2,6-dimethyl-N-morpholin-4-yl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 118385328) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is 2,6-dimethyl-N-morpholin-4-yl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2,6-dimethyl-N-morpholin-4-yl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118385328 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2,6-dimethyl-N-morpholin-4-yl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1cc(OCc2c(F)ccc(F)c2F)c2nc(C)c(C(=O)NN3CCOCC3)n2c1 |
| InChI | InChI=1S/C21H21F3N4O3/c1-12-9-17(31-11-14-15(22)3-4-16(23)18(14)24)20-25-13(2)19(28(20)10-12)21(29)26-27-5-7-30-8-6-27/h3-4,9-10H,5-8,11H2,1-2H3,(H,26,29) |
| InChIKey | QGFKWQPQFDKWLF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|