C18H14BrF3N2O3 — CID 118485078
ethyl 6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 118485078) has the molecular formula C18H14BrF3N2O3 and a molecular weight of 443.22 g/mol. Its IUPAC name is ethyl 6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118485078 |
| Molecular Formula | C18H14BrF3N2O3 |
| Molecular Weight | 443.22 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | ethyl 6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2c(OCc3c(F)ccc(F)c3F)cc(Br)cn12 |
| InChI | InChI=1S/C18H14BrF3N2O3/c1-3-26-18(25)16-9(2)23-17-14(6-10(19)7-24(16)17)27-8-11-12(20)4-5-13(21)15(11)22/h4-7H,3,8H2,1-2H3 |
| InChIKey | FZOSXYWUSZWDRA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|