C16H10BrF3N2O4 — CID 118485053
[6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl] hydrogen carbonate (PubChem CID 118485053) has the molecular formula C16H10BrF3N2O4 and a molecular weight of 431.16 g/mol. Its IUPAC name is [6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl] hydrogen carbonate.
| Compound Name | [6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118485053 |
| Molecular Formula | C16H10BrF3N2O4 |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | [6-bromo-2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl] hydrogen carbonate |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cc(Br)cn2c1OC(=O)O |
| InChI | InChI=1S/C16H10BrF3N2O4/c1-7-15(26-16(23)24)22-5-8(17)4-12(14(22)21-7)25-6-9-10(18)2-3-11(19)13(9)20/h2-5H,6H2,1H3,(H,23,24) |
| InChIKey | YFMLRCAJHHPONL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|