C43H56N4O17 — CID 159633844
carbon dioxide;N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(1H-indol-5-yloxy)benzamide (PubChem CID 159633844) has the molecular formula C43H56N4O17 and a molecular weight of 900.93 g/mol. Its IUPAC name is carbon dioxide;N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(1H-indol-5-yloxy)benzamide.
| Compound Name | carbon dioxide;N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(1H-indol-5-yloxy)benzamide |
|---|---|
| PubChem CID | 159633844 |
| Molecular Formula | C43H56N4O17 |
| Molecular Weight | 900.93 g/mol |
| Exact Mass | 900.36 |
| IUPAC Name | carbon dioxide;N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,4-dinitrophenyl)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(1H-indol-5-yloxy)benzamide |
| SMILES | O=C(NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(Oc2ccc3[nH]ccc3c2)cc1.O=C=O |
| InChI | InChI=1S/C42H56N4O15.CO2/c47-42(35-4-7-38(8-5-35)61-39-9-10-40-36(32-39)11-12-43-40)44-13-15-53-17-19-55-21-23-57-25-27-59-29-31-60-30-28-58-26-24-56-22-20-54-18-16-52-14-1-2-34-3-6-37(45(48)49)33-41(34)46(50)51;2-1-3/h3-12,32-33,43H,1-2,13-31H2,(H,44,47); |
| InChIKey | MPMDXHRYMMXZKR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 257.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.93 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|