About N-phenylprop-2-enamide;2-phenylprop-2-enamide
N-phenylprop-2-enamide;2-phenylprop-2-enamide (PubChem CID 159638703) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is N-phenylprop-2-enamide;2-phenylprop-2-enamide.
Molecular Properties
| Compound Name | N-phenylprop-2-enamide;2-phenylprop-2-enamide |
| PubChem CID | 159638703 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-phenylprop-2-enamide;2-phenylprop-2-enamide |
| SMILES | C=C(C(N)=O)c1ccccc1.C=CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/2C9H9NO/c1-7(9(10)11)8-5-3-2-4-6-8;1-2-9(11)10-8-6-4-3-5-7-8/h2-6H,1H2,(H2,10,11);2-7H,1H2,(H,10,11) |
| InChIKey | MQBMPTOKNRXTQV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenylprop-2-enamide;2-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylprop-2-enamide;2-phenylprop-2-enamide?
The IUPAC name of N-phenylprop-2-enamide;2-phenylprop-2-enamide (CID 159638703) is N-phenylprop-2-enamide;2-phenylprop-2-enamide.
What is the SMILES notation for N-phenylprop-2-enamide;2-phenylprop-2-enamide?
The canonical SMILES for N-phenylprop-2-enamide;2-phenylprop-2-enamide is C=C(C(N)=O)c1ccccc1.C=CC(=O)Nc1ccccc1.
What is the InChIKey of N-phenylprop-2-enamide;2-phenylprop-2-enamide?
The InChIKey is MQBMPTOKNRXTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H9NO/c1-7(9(10)11)8-5-3-2-4-6-8;1-2-9(11)10-8-6-4-3-5-7-8/h2-6H,1H2,(H2,10,11);2-7H,1H2,(H,10,11).
What are the key properties of N-phenylprop-2-enamide;2-phenylprop-2-enamide?
N-phenylprop-2-enamide;2-phenylprop-2-enamide has a molecular weight of 294.35 g/mol, XLogP of 3.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylprop-2-enamide;2-phenylprop-2-enamide is sourced from PubChem (CID 159638703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).