C36H72N4 — CID 159640492
4-tert-butyl-1-[[(3S)-1-tert-butylpyrrolidin-3-yl]methyl]piperidine (PubChem CID 159640492) has the molecular formula C36H72N4 and a molecular weight of 561.00 g/mol. Its IUPAC name is 4-tert-butyl-1-[[(3S)-1-tert-butylpyrrolidin-3-yl]methyl]piperidine.
| Compound Name | 4-tert-butyl-1-[[(3S)-1-tert-butylpyrrolidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 159640492 |
| Molecular Formula | C36H72N4 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.58 |
| IUPAC Name | 4-tert-butyl-1-[[(3S)-1-tert-butylpyrrolidin-3-yl]methyl]piperidine |
| SMILES | CC(C)(C)C1CCN(C[C@@H]2CCN(C(C)(C)C)C2)CC1.CC(C)(C)C1CCN(C[C@@H]2CCN(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/2C18H36N2/c2*1-17(2,3)16-8-10-19(11-9-16)13-15-7-12-20(14-15)18(4,5)6/h2*15-16H,7-14H2,1-6H3/t2*15-/m00/s1 |
| InChIKey | MQHFZDZRSPHRJE-HJIBXMCBSA-N |
| XLogP | 7.73 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |