C13H22S — CID 159640587
2-tert-butyl-3,4-dimethyl-5-propan-2-ylthiophene (PubChem CID 159640587) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 2-tert-butyl-3,4-dimethyl-5-propan-2-ylthiophene.
| Compound Name | 2-tert-butyl-3,4-dimethyl-5-propan-2-ylthiophene |
|---|---|
| PubChem CID | 159640587 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-tert-butyl-3,4-dimethyl-5-propan-2-ylthiophene |
| SMILES | Cc1c(C(C)C)sc(C(C)(C)C)c1C |
| InChI | InChI=1S/C13H22S/c1-8(2)11-9(3)10(4)12(14-11)13(5,6)7/h8H,1-7H3 |
| InChIKey | WKHLKSSMIXYLEF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |