C14H18S — CID 155456279
2-tert-butyl-3,7-dimethyl-1-benzothiophene (PubChem CID 155456279) has the molecular formula C14H18S and a molecular weight of 218.36 g/mol. Its IUPAC name is 2-tert-butyl-3,7-dimethyl-1-benzothiophene.
| Compound Name | 2-tert-butyl-3,7-dimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 155456279 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-tert-butyl-3,7-dimethyl-1-benzothiophene |
| SMILES | Cc1c(C(C)(C)C)sc2c(C)cccc12 |
| InChI | InChI=1S/C14H18S/c1-9-7-6-8-11-10(2)13(14(3,4)5)15-12(9)11/h6-8H,1-5H3 |
| InChIKey | UKVNNPHNTCFTIN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |