C9H11NO2S2 — CID 159644894
5-methyl-3H-furan-2-thione;5-methyl-3H-1,3-oxazole-2-thione (PubChem CID 159644894) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-methyl-3H-furan-2-thione;5-methyl-3H-1,3-oxazole-2-thione.
| Compound Name | 5-methyl-3H-furan-2-thione;5-methyl-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 159644894 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 5-methyl-3H-furan-2-thione;5-methyl-3H-1,3-oxazole-2-thione |
| SMILES | CC1=CCC(=S)O1.Cc1c[nH]c(=S)o1 |
| InChI | InChI=1S/C5H6OS.C4H5NOS/c1-4-2-3-5(7)6-4;1-3-2-5-4(7)6-3/h2H,3H2,1H3;2H,1H3,(H,5,7) |
| InChIKey | MQVFPXNKNHOGRA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|