C11H22O — CID 143762964
2,6-dimethyl-4H-pyran;ethane (PubChem CID 143762964) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,6-dimethyl-4H-pyran;ethane.
| Compound Name | 2,6-dimethyl-4H-pyran;ethane |
|---|---|
| PubChem CID | 143762964 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2,6-dimethyl-4H-pyran;ethane |
| SMILES | CC.CC.CC1=CCC=C(C)O1 |
| InChI | InChI=1S/C7H10O.2C2H6/c1-6-4-3-5-7(2)8-6;2*1-2/h4-5H,3H2,1-2H3;2*1-2H3 |
| InChIKey | NFXYHNFEQVPHQP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |