C26H36ClNO3 — CID 159649883
2-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-1-(3-chlorocyclobutyl)ethanone (PubChem CID 159649883) has the molecular formula C26H36ClNO3 and a molecular weight of 446.03 g/mol. Its IUPAC name is 2-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-1-(3-chlorocyclobutyl)ethanone.
| Compound Name | 2-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-1-(3-chlorocyclobutyl)ethanone |
|---|---|
| PubChem CID | 159649883 |
| Molecular Formula | C26H36ClNO3 |
| Molecular Weight | 446.03 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-1-(3-chlorocyclobutyl)ethanone |
| SMILES | O=C(CC1CCC(CCN2CCC(c3cccc4c3OCO4)CC2)CC1)C1CC(Cl)C1 |
| InChI | InChI=1S/C26H36ClNO3/c27-22-15-21(16-22)24(29)14-19-6-4-18(5-7-19)8-11-28-12-9-20(10-13-28)23-2-1-3-25-26(23)31-17-30-25/h1-3,18-22H,4-17H2 |
| InChIKey | MRKQTFLUXXFCQB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.03 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|