C22H31NO2 — CID 152987791
4-(1,3-benzodioxol-4-yl)-1-(2-spiro[2.5]octan-6-ylethyl)piperidine (PubChem CID 152987791) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-4-yl)-1-(2-spiro[2.5]octan-6-ylethyl)piperidine.
| Compound Name | 4-(1,3-benzodioxol-4-yl)-1-(2-spiro[2.5]octan-6-ylethyl)piperidine |
|---|---|
| PubChem CID | 152987791 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 4-(1,3-benzodioxol-4-yl)-1-(2-spiro[2.5]octan-6-ylethyl)piperidine |
| SMILES | c1cc2c(c(C3CCN(CCC4CCC5(CC4)CC5)CC3)c1)OCO2 |
| InChI | InChI=1S/C22H31NO2/c1-2-19(21-20(3-1)24-16-25-21)18-7-14-23(15-8-18)13-6-17-4-9-22(10-5-17)11-12-22/h1-3,17-18H,4-16H2 |
| InChIKey | UVQSKXDVTYUBGM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |