C17H17ClF3N5S — CID 159652702
8-(3-chloro-5-methylphenyl)sulfanyl-9-(5,5,5-trifluoropentyl)purin-6-amine (PubChem CID 159652702) has the molecular formula C17H17ClF3N5S and a molecular weight of 415.87 g/mol. Its IUPAC name is 8-(3-chloro-5-methylphenyl)sulfanyl-9-(5,5,5-trifluoropentyl)purin-6-amine.
| Compound Name | 8-(3-chloro-5-methylphenyl)sulfanyl-9-(5,5,5-trifluoropentyl)purin-6-amine |
|---|---|
| PubChem CID | 159652702 |
| Molecular Formula | C17H17ClF3N5S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 8-(3-chloro-5-methylphenyl)sulfanyl-9-(5,5,5-trifluoropentyl)purin-6-amine |
| SMILES | Cc1cc(Cl)cc(Sc2nc3c(N)ncnc3n2CCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H17ClF3N5S/c1-10-6-11(18)8-12(7-10)27-16-25-13-14(22)23-9-24-15(13)26(16)5-3-2-4-17(19,20)21/h6-9H,2-5H2,1H3,(H2,22,23,24) |
| InChIKey | YKMBOZXKODRFTB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|