C24H46B2BrNO5Si — CID 159656223
[2-(5-bromo-2-pyridinyl)-1,1,1-trideuteriopropan-2-yl]oxy-trimethylsilane;methane;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 159656223) has the molecular formula C24H46B2BrNO5Si and a molecular weight of 561.27 g/mol. Its IUPAC name is [2-(5-bromo-2-pyridinyl)-1,1,1-trideuteriopropan-2-yl]oxy-trimethylsilane;methane;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | [2-(5-bromo-2-pyridinyl)-1,1,1-trideuteriopropan-2-yl]oxy-trimethylsilane;methane;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159656223 |
| Molecular Formula | C24H46B2BrNO5Si |
| Molecular Weight | 561.27 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | [2-(5-bromo-2-pyridinyl)-1,1,1-trideuteriopropan-2-yl]oxy-trimethylsilane;methane;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | C.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.[2H]C([2H])([2H])C(C)(O[Si](C)(C)C)c1ccc(Br)cn1 |
| InChI | InChI=1S/C12H24B2O4.C11H18BrNOSi.CH4/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;1-11(2,14-15(3,4)5)10-7-6-9(12)8-13-10;/h1-8H3;6-8H,1-5H3;1H4/i;1D3; |
| InChIKey | MSFFVDVXUXCYKY-ICMJTWPQSA-N |
| XLogP | 6.82 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.27 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|