C15H22BrF2NOSi — CID 155595310
[1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]oxy-tert-butyl-dimethylsilane (PubChem CID 155595310) has the molecular formula C15H22BrF2NOSi and a molecular weight of 378.33 g/mol. Its IUPAC name is [1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 155595310 |
| Molecular Formula | C15H22BrF2NOSi |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1(c2ccc(Br)cn2)CC(F)(F)C1 |
| InChI | InChI=1S/C15H22BrF2NOSi/c1-13(2,3)21(4,5)20-14(9-15(17,18)10-14)12-7-6-11(16)8-19-12/h6-8H,9-10H2,1-5H3 |
| InChIKey | MWRNKXCVKLDDHG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|