C19H16F6IrNO2- — CID 159657091
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;4-hydroxypent-3-en-2-one;iridium (PubChem CID 159657091) has the molecular formula C19H16F6IrNO2- and a molecular weight of 596.55 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 159657091 |
| Molecular Formula | C19H16F6IrNO2- |
| Molecular Weight | 596.55 g/mol |
| Exact Mass | 597.07 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.Cc1ccnc(-c2[c-]c(C(F)(F)F)cc(C(F)(F)F)c2)c1.[Ir] |
| InChI | InChI=1S/C14H8F6N.C5H8O2.Ir/c1-8-2-3-21-12(4-8)9-5-10(13(15,16)17)7-11(6-9)14(18,19)20;1-4(6)3-5(2)7;/h2-5,7H,1H3;3,6H,1-2H3;/q-1;; |
| InChIKey | CXAPQYBVRSWLQK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|