C30H32F2N2O5S — CID 159657626
3-(1,1-difluoro-3-methyl-2-methylidenebutoxy)-N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]benzenesulfonamide (PubChem CID 159657626) has the molecular formula C30H32F2N2O5S and a molecular weight of 570.66 g/mol. Its IUPAC name is 3-(1,1-difluoro-3-methyl-2-methylidenebutoxy)-N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]benzenesulfonamide.
| Compound Name | 3-(1,1-difluoro-3-methyl-2-methylidenebutoxy)-N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 159657626 |
| Molecular Formula | C30H32F2N2O5S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 3-(1,1-difluoro-3-methyl-2-methylidenebutoxy)-N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]benzenesulfonamide |
| SMILES | C=C(C(C)C)C(F)(F)Oc1cccc(S(=O)(=O)N[C@@H]2CCC[C@H](N3c4ccccc4Oc4ccccc43)[C@H]2O)c1 |
| InChI | InChI=1S/C30H32F2N2O5S/c1-19(2)20(3)30(31,32)39-21-10-8-11-22(18-21)40(36,37)33-23-12-9-15-26(29(23)35)34-24-13-4-6-16-27(24)38-28-17-7-5-14-25(28)34/h4-8,10-11,13-14,16-19,23,26,29,33,35H,3,9,12,15H2,1-2H3/t23-,26+,29+/m1/s1 |
| InChIKey | SIWQDTIWZKKTSU-IXLXJOPFSA-N |
| XLogP | 6.37 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|