C19H22N2O4S — CID 161459830
N-[(1S,2S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]methanesulfonamide (PubChem CID 161459830) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]methanesulfonamide.
| Compound Name | N-[(1S,2S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 161459830 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[(1S,2S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC(N2c3ccccc3Oc3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C19H22N2O4S/c1-26(23,24)20-13-7-6-10-16(19(13)22)21-14-8-2-4-11-17(14)25-18-12-5-3-9-15(18)21/h2-5,8-9,11-13,16,19-20,22H,6-7,10H2,1H3/t13-,16?,19+/m0/s1 |
| InChIKey | DXCCFEMLXVGUCI-SDFDQKQISA-N |
| XLogP | 2.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |