C27H28N2O5S — CID 155077305
N-[(1R,2R)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-propanoylbenzenesulfonamide (PubChem CID 155077305) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-propanoylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-propanoylbenzenesulfonamide |
|---|---|
| PubChem CID | 155077305 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-[(1R,2R)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-propanoylbenzenesulfonamide |
| SMILES | CCC(=O)c1ccc(S(=O)(=O)N[C@@H]2CCCC(N3c4ccccc4Oc4ccccc43)[C@H]2O)cc1 |
| InChI | InChI=1S/C27H28N2O5S/c1-2-24(30)18-14-16-19(17-15-18)35(32,33)28-20-8-7-11-23(27(20)31)29-21-9-3-5-12-25(21)34-26-13-6-4-10-22(26)29/h3-6,9-10,12-17,20,23,27-28,31H,2,7-8,11H2,1H3/t20-,23?,27+/m1/s1 |
| InChIKey | YTLVZIOYRURERN-UKGJWRKASA-N |
| XLogP | 4.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |