C29H29ClO6 — CID 159657677
3-O-tert-butyl 1-O-propyl 4-(2-chloro-6-phenylmethoxycarbonylphenyl)benzene-1,3-dicarboxylate (PubChem CID 159657677) has the molecular formula C29H29ClO6 and a molecular weight of 509.00 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-propyl 4-(2-chloro-6-phenylmethoxycarbonylphenyl)benzene-1,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-propyl 4-(2-chloro-6-phenylmethoxycarbonylphenyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 159657677 |
| Molecular Formula | C29H29ClO6 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 3-O-tert-butyl 1-O-propyl 4-(2-chloro-6-phenylmethoxycarbonylphenyl)benzene-1,3-dicarboxylate |
| SMILES | CCCOC(=O)c1ccc(-c2c(Cl)cccc2C(=O)OCc2ccccc2)c(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C29H29ClO6/c1-5-16-34-26(31)20-14-15-21(23(17-20)28(33)36-29(2,3)4)25-22(12-9-13-24(25)30)27(32)35-18-19-10-7-6-8-11-19/h6-15,17H,5,16,18H2,1-4H3 |
| InChIKey | MSJPRGNUPHGXSI-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|