C14H24N2 — CID 159662384
3,8-dimethyl-8-azabicyclo[3.2.1]oct-2-ene;1,3-dimethyl-2H-azete (PubChem CID 159662384) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 3,8-dimethyl-8-azabicyclo[3.2.1]oct-2-ene;1,3-dimethyl-2H-azete.
| Compound Name | 3,8-dimethyl-8-azabicyclo[3.2.1]oct-2-ene;1,3-dimethyl-2H-azete |
|---|---|
| PubChem CID | 159662384 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 3,8-dimethyl-8-azabicyclo[3.2.1]oct-2-ene;1,3-dimethyl-2H-azete |
| SMILES | CC1=CC2CCC(C1)N2C.CC1=CN(C)C1 |
| InChI | InChI=1S/C9H15N.C5H9N/c1-7-5-8-3-4-9(6-7)10(8)2;1-5-3-6(2)4-5/h5,8-9H,3-4,6H2,1-2H3;3H,4H2,1-2H3 |
| InChIKey | MSZBXZPHDPNURC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|