C16H18F3N — CID 171975237
8-methyl-3-[3-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 171975237) has the molecular formula C16H18F3N and a molecular weight of 281.32 g/mol. Its IUPAC name is 8-methyl-3-[3-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-methyl-3-[3-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 171975237 |
| Molecular Formula | C16H18F3N |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 8-methyl-3-[3-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | Cc1cc(C2=CC3CCC(C2)N3C)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H18F3N/c1-10-7-11(3-6-15(10)16(17,18)19)12-8-13-4-5-14(9-12)20(13)2/h3,6-8,13-14H,4-5,9H2,1-2H3 |
| InChIKey | FXDCTBZXCFXQLI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |