C29H33Cl2F4N7O4S — CID 159665251
ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]-2,2-difluoropropanoate;ethyl 3-(2,6-diaminoanilino)-2,2-difluoropropanoate (PubChem CID 159665251) has the molecular formula C29H33Cl2F4N7O4S and a molecular weight of 722.59 g/mol. Its IUPAC name is ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]-2,2-difluoropropanoate;ethyl 3-(2,6-diaminoanilino)-2,2-difluoropropanoate.
| Compound Name | ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]-2,2-difluoropropanoate;ethyl 3-(2,6-diaminoanilino)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 159665251 |
| Molecular Formula | C29H33Cl2F4N7O4S |
| Molecular Weight | 722.59 g/mol |
| Exact Mass | 721.16 |
| IUPAC Name | ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]-2,2-difluoropropanoate;ethyl 3-(2,6-diaminoanilino)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)CNc1c(N)cccc1N.CCOC(=O)C(F)(F)CNc1c(N)cccc1NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2F2N4O2S.C11H15F2N3O2/c1-2-28-16(27)18(21,22)9-24-15-12(23)4-3-5-14(15)26-17(29)25-13-7-6-10(19)8-11(13)20;1-2-18-10(17)11(12,13)6-16-9-7(14)4-3-5-8(9)15/h3-8,24H,2,9,23H2,1H3,(H2,25,26,29);3-5,16H,2,6,14-15H2,1H3 |
| InChIKey | MTIAXIISBOTBHB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|