C29H37Cl2N7O4S — CID 161167068
ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]propanoate;ethyl 3-(2,6-diaminoanilino)propanoate (PubChem CID 161167068) has the molecular formula C29H37Cl2N7O4S and a molecular weight of 650.63 g/mol. Its IUPAC name is ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]propanoate;ethyl 3-(2,6-diaminoanilino)propanoate.
| Compound Name | ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]propanoate;ethyl 3-(2,6-diaminoanilino)propanoate |
|---|---|
| PubChem CID | 161167068 |
| Molecular Formula | C29H37Cl2N7O4S |
| Molecular Weight | 650.63 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | ethyl 3-[2-amino-6-[(2,4-dichlorophenyl)carbamothioylamino]anilino]propanoate;ethyl 3-(2,6-diaminoanilino)propanoate |
| SMILES | CCOC(=O)CCNc1c(N)cccc1N.CCOC(=O)CCNc1c(N)cccc1NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N4O2S.C11H17N3O2/c1-2-26-16(25)8-9-22-17-13(21)4-3-5-15(17)24-18(27)23-14-7-6-11(19)10-12(14)20;1-2-16-10(15)6-7-14-11-8(12)4-3-5-9(11)13/h3-7,10,22H,2,8-9,21H2,1H3,(H2,23,24,27);3-5,14H,2,6-7,12-13H2,1H3 |
| InChIKey | UQRJYQGWTFMXID-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|