C23H40F2N2O8 — CID 159665377
(2S)-2-amino-9,9-difluoro-N-[(2S,5R)-5-methyl-3,6-dioxoheptan-2-yl]-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanamide (PubChem CID 159665377) has the molecular formula C23H40F2N2O8 and a molecular weight of 510.58 g/mol. Its IUPAC name is (2S)-2-amino-9,9-difluoro-N-[(2S,5R)-5-methyl-3,6-dioxoheptan-2-yl]-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanamide.
| Compound Name | (2S)-2-amino-9,9-difluoro-N-[(2S,5R)-5-methyl-3,6-dioxoheptan-2-yl]-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanamide |
|---|---|
| PubChem CID | 159665377 |
| Molecular Formula | C23H40F2N2O8 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (2S)-2-amino-9,9-difluoro-N-[(2S,5R)-5-methyl-3,6-dioxoheptan-2-yl]-9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanamide |
| SMILES | CC(=O)[C@H](C)CC(=O)[C@H](C)NC(=O)[C@@H](N)CCCCCCC(F)(F)[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H40F2N2O8/c1-12(14(3)29)10-16(30)13(2)27-22(34)15(26)8-6-4-5-7-9-23(24,25)21-20(33)19(32)18(31)17(11-28)35-21/h12-13,15,17-21,28,31-33H,4-11,26H2,1-3H3,(H,27,34)/t12-,13+,15+,17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | CZVRWAPQJLFXNZ-HKDKORKMSA-N |
| XLogP | -0.18 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|