C22H40N2O9 — CID 159329375
(2R,5S)-5-[[(2S)-2-amino-9-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid (PubChem CID 159329375) has the molecular formula C22H40N2O9 and a molecular weight of 476.57 g/mol. Its IUPAC name is (2R,5S)-5-[[(2S)-2-amino-9-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid.
| Compound Name | (2R,5S)-5-[[(2S)-2-amino-9-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 159329375 |
| Molecular Formula | C22H40N2O9 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (2R,5S)-5-[[(2S)-2-amino-9-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid |
| SMILES | C[C@H](CC(=O)[C@H](C)NC(=O)[C@@H](N)CCCCCCC[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C22H40N2O9/c1-12(22(31)32)10-15(26)13(2)24-21(30)14(23)8-6-4-3-5-7-9-16-18(27)20(29)19(28)17(11-25)33-16/h12-14,16-20,25,27-29H,3-11,23H2,1-2H3,(H,24,30)(H,31,32)/t12-,13+,14+,16+,17-,18+,19+,20-/m1/s1 |
| InChIKey | MQSZDGOYUMPLFF-WAAXHAEHSA-N |
| XLogP | -0.93 |
| TPSA | 199.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|