C22H40N2O10 — CID 157424377
(2R,5S)-5-[[(2S)-2-amino-9-[(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid (PubChem CID 157424377) has the molecular formula C22H40N2O10 and a molecular weight of 492.57 g/mol. Its IUPAC name is (2R,5S)-5-[[(2S)-2-amino-9-[(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid.
| Compound Name | (2R,5S)-5-[[(2S)-2-amino-9-[(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 157424377 |
| Molecular Formula | C22H40N2O10 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (2R,5S)-5-[[(2S)-2-amino-9-[(3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]nonanoyl]amino]-2-methyl-4-oxohexanoic acid |
| SMILES | C[C@H](CC(=O)[C@H](C)NC(=O)[C@@H](N)CCCCCCCC1(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C22H40N2O10/c1-12(21(31)32)10-15(26)13(2)24-20(30)14(23)8-6-4-3-5-7-9-22(33)19(29)18(28)17(27)16(11-25)34-22/h12-14,16-19,25,27-29,33H,3-11,23H2,1-2H3,(H,24,30)(H,31,32)/t12-,13+,14+,16-,17+,18+,19-,22?/m1/s1 |
| InChIKey | YQHGNOUIANWIQG-ZQKMGLDVSA-N |
| XLogP | -1.61 |
| TPSA | 219.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|