C11H6ClF6N — CID 159665833
7,8-bis(trifluoromethyl)isoquinoline;hydrochloride (PubChem CID 159665833) has the molecular formula C11H6ClF6N and a molecular weight of 301.62 g/mol. Its IUPAC name is 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride.
| Compound Name | 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 159665833 |
| Molecular Formula | C11H6ClF6N |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc2ccncc2c1C(F)(F)F |
| InChI | InChI=1S/C11H5F6N.ClH/c12-10(13,14)8-2-1-6-3-4-18-5-7(6)9(8)11(15,16)17;/h1-5H;1H |
| InChIKey | MTJRENUZVYAMQL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |