About 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride
7,8-bis(trifluoromethyl)isoquinoline;hydrochloride (PubChem CID 159665833) has the molecular formula C11H6ClF6N
and a molecular weight of 301.62 g/mol. Its IUPAC name is 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride |
| PubChem CID | 159665833 |
| Molecular Formula | C11H6ClF6N |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc2ccncc2c1C(F)(F)F |
| InChI | InChI=1S/C11H5F6N.ClH/c12-10(13,14)8-2-1-6-3-4-18-5-7(6)9(8)11(15,16)17;/h1-5H;1H |
| InChIKey | MTJRENUZVYAMQL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride?
The IUPAC name of 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride (CID 159665833) is 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride.
What is the SMILES notation for 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride?
The canonical SMILES for 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride is Cl.FC(F)(F)c1ccc2ccncc2c1C(F)(F)F.
What is the InChIKey of 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride?
The InChIKey is MTJRENUZVYAMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F6N.ClH/c12-10(13,14)8-2-1-6-3-4-18-5-7(6)9(8)11(15,16)17;/h1-5H;1H.
What are the key properties of 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride?
7,8-bis(trifluoromethyl)isoquinoline;hydrochloride has a molecular weight of 301.62 g/mol, XLogP of 4.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-bis(trifluoromethyl)isoquinoline;hydrochloride is sourced from PubChem (CID 159665833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).