About 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine
1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine (PubChem CID 137437666) has the molecular formula C8H5F3N2O
and a molecular weight of 202.14 g/mol. Its IUPAC name is 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine |
| PubChem CID | 137437666 |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine |
| SMILES | On1cc(C(F)(F)F)c2cnccc21 |
| InChI | InChI=1S/C8H5F3N2O/c9-8(10,11)6-4-13(14)7-1-2-12-3-5(6)7/h1-4,14H |
| InChIKey | NFVVIKCFMWVWJH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine?
The IUPAC name of 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine (CID 137437666) is 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine?
The canonical SMILES for 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine is On1cc(C(F)(F)F)c2cnccc21.
What is the InChIKey of 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine?
The InChIKey is NFVVIKCFMWVWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2O/c9-8(10,11)6-4-13(14)7-1-2-12-3-5(6)7/h1-4,14H.
What are the key properties of 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine?
1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine has a molecular weight of 202.14 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3-(trifluoromethyl)pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 137437666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).