C26H29N5O3S — CID 159668879
N-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 159668879) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is N-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 159668879 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[[4-[2-(1H-indazol-5-yl)acetyl]phenyl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCc1ccc(C(=O)Cc2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C26H29N5O3S/c32-22(12-17-7-10-20-19(11-17)14-28-31-20)18-8-5-16(6-9-18)13-27-24(33)4-2-1-3-23-25-21(15-35-23)29-26(34)30-25/h5-11,14,21,23,25H,1-4,12-13,15H2,(H,27,33)(H,28,31)(H2,29,30,34) |
| InChIKey | MTTKWXQNBILGJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|