C8H17Cl2NO6S2 — CID 159672140
N,N-dichloro-1-(2-ethoxyethylsulfonyl)-2-methylpropan-2-amine;sulfur trioxide (PubChem CID 159672140) has the molecular formula C8H17Cl2NO6S2 and a molecular weight of 358.27 g/mol. Its IUPAC name is N,N-dichloro-1-(2-ethoxyethylsulfonyl)-2-methylpropan-2-amine;sulfur trioxide.
| Compound Name | N,N-dichloro-1-(2-ethoxyethylsulfonyl)-2-methylpropan-2-amine;sulfur trioxide |
|---|---|
| PubChem CID | 159672140 |
| Molecular Formula | C8H17Cl2NO6S2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N,N-dichloro-1-(2-ethoxyethylsulfonyl)-2-methylpropan-2-amine;sulfur trioxide |
| SMILES | CCOCCS(=O)(=O)CC(C)(C)N(Cl)Cl.O=S(=O)=O |
| InChI | InChI=1S/C8H17Cl2NO3S.O3S/c1-4-14-5-6-15(12,13)7-8(2,3)11(9)10;1-4(2)3/h4-7H2,1-3H3; |
| InChIKey | MUDCDPXUHFJLLG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|