C12H26ClNO8S2 — CID 87691639
2-[2-[2-[2-[2-(chloroamino)-2-methylpropyl]sulfonylethoxy]ethoxy]ethoxy]ethanesulfonic acid (PubChem CID 87691639) has the molecular formula C12H26ClNO8S2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(chloroamino)-2-methylpropyl]sulfonylethoxy]ethoxy]ethoxy]ethanesulfonic acid.
| Compound Name | 2-[2-[2-[2-[2-(chloroamino)-2-methylpropyl]sulfonylethoxy]ethoxy]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 87691639 |
| Molecular Formula | C12H26ClNO8S2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-[2-[2-[2-[2-(chloroamino)-2-methylpropyl]sulfonylethoxy]ethoxy]ethoxy]ethanesulfonic acid |
| SMILES | CC(C)(CS(=O)(=O)CCOCCOCCOCCS(=O)(=O)O)NCl |
| InChI | InChI=1S/C12H26ClNO8S2/c1-12(2,14-13)11-23(15,16)9-7-21-5-3-20-4-6-22-8-10-24(17,18)19/h14H,3-11H2,1-2H3,(H,17,18,19) |
| InChIKey | IOHRDRWLEBOFNO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|