C11H25NO5S — CID 86665515
2-[2-[2-(3-amino-3-methylbutyl)sulfonylethoxy]ethoxy]ethanol (PubChem CID 86665515) has the molecular formula C11H25NO5S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-[2-[2-(3-amino-3-methylbutyl)sulfonylethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(3-amino-3-methylbutyl)sulfonylethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 86665515 |
| Molecular Formula | C11H25NO5S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[2-[2-(3-amino-3-methylbutyl)sulfonylethoxy]ethoxy]ethanol |
| SMILES | CC(C)(N)CCS(=O)(=O)CCOCCOCCO |
| InChI | InChI=1S/C11H25NO5S/c1-11(2,12)3-9-18(14,15)10-8-17-7-6-16-5-4-13/h13H,3-10,12H2,1-2H3 |
| InChIKey | GHZDQKRJLYQMKW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|