C25H28BrN7O2 — CID 159674175
5-(5-amino-2-methylphenyl)-2-(2-methoxyethylamino)pyridine-3-carbonitrile;5-bromo-2-(2-methoxyethylamino)pyridine-3-carbonitrile (PubChem CID 159674175) has the molecular formula C25H28BrN7O2 and a molecular weight of 538.45 g/mol. Its IUPAC name is 5-(5-amino-2-methylphenyl)-2-(2-methoxyethylamino)pyridine-3-carbonitrile;5-bromo-2-(2-methoxyethylamino)pyridine-3-carbonitrile.
| Compound Name | 5-(5-amino-2-methylphenyl)-2-(2-methoxyethylamino)pyridine-3-carbonitrile;5-bromo-2-(2-methoxyethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 159674175 |
| Molecular Formula | C25H28BrN7O2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 5-(5-amino-2-methylphenyl)-2-(2-methoxyethylamino)pyridine-3-carbonitrile;5-bromo-2-(2-methoxyethylamino)pyridine-3-carbonitrile |
| SMILES | COCCNc1ncc(-c2cc(N)ccc2C)cc1C#N.COCCNc1ncc(Br)cc1C#N |
| InChI | InChI=1S/C16H18N4O.C9H10BrN3O/c1-11-3-4-14(18)8-15(11)13-7-12(9-17)16(20-10-13)19-5-6-21-2;1-14-3-2-12-9-7(5-11)4-8(10)6-13-9/h3-4,7-8,10H,5-6,18H2,1-2H3,(H,19,20);4,6H,2-3H2,1H3,(H,12,13) |
| InChIKey | MUJOAZGGLUHMIR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 141.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|