C24H37N7O8 — CID 159674811
acetic acid;ethyl 3-[[(3S)-1-[4-[N'-[2-(dimethylamino)ethylcarbamoyloxy]carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate (PubChem CID 159674811) has the molecular formula C24H37N7O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is acetic acid;ethyl 3-[[(3S)-1-[4-[N'-[2-(dimethylamino)ethylcarbamoyloxy]carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate.
| Compound Name | acetic acid;ethyl 3-[[(3S)-1-[4-[N'-[2-(dimethylamino)ethylcarbamoyloxy]carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 159674811 |
| Molecular Formula | C24H37N7O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | acetic acid;ethyl 3-[[(3S)-1-[4-[N'-[2-(dimethylamino)ethylcarbamoyloxy]carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
| SMILES | CC(=O)O.CCOC(=O)CCNC(=O)N[C@H]1CCN(c2ccc(C(N)=NOC(=O)NCCN(C)C)cc2)C1=O |
| InChI | InChI=1S/C22H33N7O6.C2H4O2/c1-4-34-18(30)9-11-24-21(32)26-17-10-13-29(20(17)31)16-7-5-15(6-8-16)19(23)27-35-22(33)25-12-14-28(2)3;1-2(3)4/h5-8,17H,4,9-14H2,1-3H3,(H2,23,27)(H,25,33)(H2,24,26,32);1H3,(H,3,4)/t17-;/m0./s1 |
| InChIKey | MULSTAHVOFWWEA-LMOVPXPDSA-N |
| XLogP | 0.04 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|