C21H30N6O6 — CID 173254289
pentyl 3-[[(3S)-1-[4-(N'-carbamoyloxycarbamimidoyl)phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate (PubChem CID 173254289) has the molecular formula C21H30N6O6 and a molecular weight of 462.51 g/mol. Its IUPAC name is pentyl 3-[[(3S)-1-[4-(N'-carbamoyloxycarbamimidoyl)phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate.
| Compound Name | pentyl 3-[[(3S)-1-[4-(N'-carbamoyloxycarbamimidoyl)phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 173254289 |
| Molecular Formula | C21H30N6O6 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | pentyl 3-[[(3S)-1-[4-(N'-carbamoyloxycarbamimidoyl)phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
| SMILES | CCCCCOC(=O)CCNC(=O)N[C@H]1CCN(c2ccc(C(N)=NOC(N)=O)cc2)C1=O |
| InChI | InChI=1S/C21H30N6O6/c1-2-3-4-13-32-17(28)9-11-24-21(31)25-16-10-12-27(19(16)29)15-7-5-14(6-8-15)18(22)26-33-20(23)30/h5-8,16H,2-4,9-13H2,1H3,(H2,22,26)(H2,23,30)(H2,24,25,31)/t16-/m0/s1 |
| InChIKey | RHHCNVQAQCKNLL-INIZCTEOSA-N |
| XLogP | 0.93 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|